C39H54F2O4 — CID 154808521
(1R,4R,5R,11E,13R,19S)-11-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-10-one (PubChem CID 154808521) has the molecular formula C39H54F2O4 and a molecular weight of 624.85 g/mol. Its IUPAC name is (1R,4R,5R,11E,13R,19S)-11-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-10-one.
| Compound Name | (1R,4R,5R,11E,13R,19S)-11-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-10-one |
|---|---|
| PubChem CID | 154808521 |
| Molecular Formula | C39H54F2O4 |
| Molecular Weight | 624.85 g/mol |
| Exact Mass | 624.40 |
| IUPAC Name | (1R,4R,5R,11E,13R,19S)-11-[[4-(difluoromethoxy)-3-methoxyphenyl]methylidene]-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-10-one |
| SMILES | COc1cc(/C=C2\C[C@@]3(C)C(CC[C@]4(C)C3CCC3C5[C@@H]6OC[C@@]5(CCC6(C)C)CC[C@]34C)C(C)(C)C2=O)ccc1OC(F)F |
| InChI | InChI=1S/C39H54F2O4/c1-34(2)15-17-39-18-16-37(6)25(30(39)32(34)44-22-39)10-12-29-36(5)21-24(31(42)35(3,4)28(36)13-14-38(29,37)7)19-23-9-11-26(45-33(40)41)27(20-23)43-8/h9,11,19-20,25,28-30,32-33H,10,12-18,21-22H2,1-8H3/b24-19+/t25?,28?,29?,30?,32-,36-,37+,38+,39+/m0/s1 |
| InChIKey | CVFOVLXJRYURMA-QBXGXVBNSA-N |
| XLogP | 9.75 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.85 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|