C48H66O2 — CID 71700146
(1R,4R,5R,11E,13R,19R)-4,5,9,9,13,20,20-heptamethyl-11-[[4-(4-pentylphenyl)phenyl]methylidene]-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-10-one (PubChem CID 71700146) has the molecular formula C48H66O2 and a molecular weight of 675.05 g/mol. Its IUPAC name is (1R,4R,5R,11E,13R,19R)-4,5,9,9,13,20,20-heptamethyl-11-[[4-(4-pentylphenyl)phenyl]methylidene]-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-10-one.
| Compound Name | (1R,4R,5R,11E,13R,19R)-4,5,9,9,13,20,20-heptamethyl-11-[[4-(4-pentylphenyl)phenyl]methylidene]-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-10-one |
|---|---|
| PubChem CID | 71700146 |
| Molecular Formula | C48H66O2 |
| Molecular Weight | 675.05 g/mol |
| Exact Mass | 674.51 |
| IUPAC Name | (1R,4R,5R,11E,13R,19R)-4,5,9,9,13,20,20-heptamethyl-11-[[4-(4-pentylphenyl)phenyl]methylidene]-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-10-one |
| SMILES | CCCCCc1ccc(-c2ccc(/C=C3\C[C@@]4(C)C(CC[C@]5(C)C4CCC4C6[C@H]7OC[C@@]6(CCC7(C)C)CC[C@]45C)C(C)(C)C3=O)cc2)cc1 |
| InChI | InChI=1S/C48H66O2/c1-9-10-11-12-32-13-17-34(18-14-32)35-19-15-33(16-20-35)29-36-30-45(6)38(44(4,5)41(36)49)23-24-47(8)39(45)22-21-37-40-42-43(2,3)25-27-48(40,31-50-42)28-26-46(37,47)7/h13-20,29,37-40,42H,9-12,21-28,30-31H2,1-8H3/b36-29+/t37?,38?,39?,40?,42-,45+,46-,47-,48-/m1/s1 |
| InChIKey | CHRHRGYTBOPZBF-ICMURWMFSA-N |
| XLogP | 12.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.05 |
| LogP ≤ 5 | 12.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|