C35H50O3 — CID 171156927
(1R,4R,5R,13R,19R)-11-(furan-2-ylmethylidene)-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-10-one (PubChem CID 171156927) has the molecular formula C35H50O3 and a molecular weight of 518.78 g/mol. Its IUPAC name is (1R,4R,5R,13R,19R)-11-(furan-2-ylmethylidene)-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-10-one.
| Compound Name | (1R,4R,5R,13R,19R)-11-(furan-2-ylmethylidene)-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-10-one |
|---|---|
| PubChem CID | 171156927 |
| Molecular Formula | C35H50O3 |
| Molecular Weight | 518.78 g/mol |
| Exact Mass | 518.38 |
| IUPAC Name | (1R,4R,5R,13R,19R)-11-(furan-2-ylmethylidene)-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-10-one |
| SMILES | CC1(C)C(=O)C(=Cc2ccco2)C[C@@]2(C)C1CC[C@]1(C)C2CCC2C3[C@H]4OC[C@@]3(CCC4(C)C)CC[C@]21C |
| InChI | InChI=1S/C35H50O3/c1-30(2)14-16-35-17-15-33(6)24(27(35)29(30)38-21-35)10-11-26-32(5)20-22(19-23-9-8-18-37-23)28(36)31(3,4)25(32)12-13-34(26,33)7/h8-9,18-19,24-27,29H,10-17,20-21H2,1-7H3/t24?,25?,26?,27?,29-,32+,33-,34-,35-/m1/s1 |
| InChIKey | MPAPPMPDRHHDIF-KLTAJYOSSA-N |
| XLogP | 8.73 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.78 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|