C36H54N2O2 — CID 78153669
11-[(1,5-dimethylpyrazol-4-yl)methylidene]-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-10-one (PubChem CID 78153669) has the molecular formula C36H54N2O2 and a molecular weight of 546.84 g/mol. Its IUPAC name is 11-[(1,5-dimethylpyrazol-4-yl)methylidene]-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-10-one.
| Compound Name | 11-[(1,5-dimethylpyrazol-4-yl)methylidene]-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-10-one |
|---|---|
| PubChem CID | 78153669 |
| Molecular Formula | C36H54N2O2 |
| Molecular Weight | 546.84 g/mol |
| Exact Mass | 546.42 |
| IUPAC Name | 11-[(1,5-dimethylpyrazol-4-yl)methylidene]-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-10-one |
| SMILES | Cc1c(C=C2CC3(C)C(CCC4(C)C3CCC3C5C6OCC5(CCC6(C)C)CCC34C)C(C)(C)C2=O)cnn1C |
| InChI | InChI=1S/C36H54N2O2/c1-22-24(20-37-38(22)9)18-23-19-33(6)26(32(4,5)29(23)39)12-13-35(8)27(33)11-10-25-28-30-31(2,3)14-16-36(28,21-40-30)17-15-34(25,35)7/h18,20,25-28,30H,10-17,19,21H2,1-9H3 |
| InChIKey | ZZKYIWDKKVRQON-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.84 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|