C34H52O4 — CID 171156931
ethyl 2-[(1R,4R,5R,13R,19R)-4,5,9,9,13,20,20-heptamethyl-10-oxo-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-11-ylidene]acetate (PubChem CID 171156931) has the molecular formula C34H52O4 and a molecular weight of 524.79 g/mol. Its IUPAC name is ethyl 2-[(1R,4R,5R,13R,19R)-4,5,9,9,13,20,20-heptamethyl-10-oxo-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-11-ylidene]acetate.
| Compound Name | ethyl 2-[(1R,4R,5R,13R,19R)-4,5,9,9,13,20,20-heptamethyl-10-oxo-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-11-ylidene]acetate |
|---|---|
| PubChem CID | 171156931 |
| Molecular Formula | C34H52O4 |
| Molecular Weight | 524.79 g/mol |
| Exact Mass | 524.39 |
| IUPAC Name | ethyl 2-[(1R,4R,5R,13R,19R)-4,5,9,9,13,20,20-heptamethyl-10-oxo-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-11-ylidene]acetate |
| SMILES | CCOC(=O)C=C1C[C@@]2(C)C(CC[C@]3(C)C2CCC2C4[C@H]5OC[C@@]4(CCC5(C)C)CC[C@]23C)C(C)(C)C1=O |
| InChI | InChI=1S/C34H52O4/c1-9-37-25(35)18-21-19-31(6)23(30(4,5)27(21)36)12-13-33(8)24(31)11-10-22-26-28-29(2,3)14-16-34(26,20-38-28)17-15-32(22,33)7/h18,22-24,26,28H,9-17,19-20H2,1-8H3/t22?,23?,24?,26?,28-,31+,32-,33-,34-/m1/s1 |
| InChIKey | SUNGIAGTTRIRSA-HSDXPVBUSA-N |
| XLogP | 7.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.79 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|