C13H18FN3O3 — CID 154811334
[(3aS,7aR)-2-(5-fluoro-4-methoxypyrimidin-2-yl)-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-3a-yl]methanol (PubChem CID 154811334) has the molecular formula C13H18FN3O3 and a molecular weight of 283.30 g/mol. Its IUPAC name is [(3aS,7aR)-2-(5-fluoro-4-methoxypyrimidin-2-yl)-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-3a-yl]methanol.
| Compound Name | [(3aS,7aR)-2-(5-fluoro-4-methoxypyrimidin-2-yl)-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-3a-yl]methanol |
|---|---|
| PubChem CID | 154811334 |
| Molecular Formula | C13H18FN3O3 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | [(3aS,7aR)-2-(5-fluoro-4-methoxypyrimidin-2-yl)-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-3a-yl]methanol |
| SMILES | COc1nc(N2C[C@@H]3CCOC[C@]3(CO)C2)ncc1F |
| InChI | InChI=1S/C13H18FN3O3/c1-19-11-10(14)4-15-12(16-11)17-5-9-2-3-20-8-13(9,6-17)7-18/h4,9,18H,2-3,5-8H2,1H3/t9-,13+/m0/s1 |
| InChIKey | QLNJZSHIPFPFAU-TVQRCGJNSA-N |
| XLogP | 0.46 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |