C19H19F3N2O3 — CID 154811365
(3aR,7aR)-2-[2-methyl-6-(trifluoromethyl)quinolin-4-yl]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 154811365) has the molecular formula C19H19F3N2O3 and a molecular weight of 380.37 g/mol. Its IUPAC name is (3aR,7aR)-2-[2-methyl-6-(trifluoromethyl)quinolin-4-yl]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aR,7aR)-2-[2-methyl-6-(trifluoromethyl)quinolin-4-yl]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 154811365 |
| Molecular Formula | C19H19F3N2O3 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | (3aR,7aR)-2-[2-methyl-6-(trifluoromethyl)quinolin-4-yl]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | Cc1cc(N2C[C@@H]3CCOC[C@]3(C(=O)O)C2)c2cc(C(F)(F)F)ccc2n1 |
| InChI | InChI=1S/C19H19F3N2O3/c1-11-6-16(14-7-12(19(20,21)22)2-3-15(14)23-11)24-8-13-4-5-27-10-18(13,9-24)17(25)26/h2-3,6-7,13H,4-5,8-10H2,1H3,(H,25,26)/t13-,18+/m0/s1 |
| InChIKey | QEMWTDUTUJTQTQ-SCLBCKFNSA-N |
| XLogP | 3.49 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |