C33H41F2N5O5S — CID 154813448
(1S,5S,7S,20R)-5-[(4,4-difluorocyclohexyl)amino]-22-[(4-methylsulfonylphenyl)methyl]-3,9,19,22-tetrazatetracyclo[18.2.1.03,7.011,16]tricosa-11,13,15-triene-2,8,18-trione (PubChem CID 154813448) has the molecular formula C33H41F2N5O5S and a molecular weight of 657.78 g/mol. Its IUPAC name is (1S,5S,7S,20R)-5-[(4,4-difluorocyclohexyl)amino]-22-[(4-methylsulfonylphenyl)methyl]-3,9,19,22-tetrazatetracyclo[18.2.1.03,7.011,16]tricosa-11,13,15-triene-2,8,18-trione.
| Compound Name | (1S,5S,7S,20R)-5-[(4,4-difluorocyclohexyl)amino]-22-[(4-methylsulfonylphenyl)methyl]-3,9,19,22-tetrazatetracyclo[18.2.1.03,7.011,16]tricosa-11,13,15-triene-2,8,18-trione |
|---|---|
| PubChem CID | 154813448 |
| Molecular Formula | C33H41F2N5O5S |
| Molecular Weight | 657.78 g/mol |
| Exact Mass | 657.28 |
| IUPAC Name | (1S,5S,7S,20R)-5-[(4,4-difluorocyclohexyl)amino]-22-[(4-methylsulfonylphenyl)methyl]-3,9,19,22-tetrazatetracyclo[18.2.1.03,7.011,16]tricosa-11,13,15-triene-2,8,18-trione |
| SMILES | CS(=O)(=O)c1ccc(CN2C[C@H]3C[C@H]2C(=O)N2C[C@@H](NC4CCC(F)(F)CC4)C[C@H]2C(=O)NCc2ccccc2CC(=O)N3)cc1 |
| InChI | InChI=1S/C33H41F2N5O5S/c1-46(44,45)27-8-6-21(7-9-27)18-39-19-25-16-29(39)32(43)40-20-26(37-24-10-12-33(34,35)13-11-24)15-28(40)31(42)36-17-23-5-3-2-4-22(23)14-30(41)38-25/h2-9,24-26,28-29,37H,10-20H2,1H3,(H,36,42)(H,38,41)/t25-,26+,28+,29+/m1/s1 |
| InChIKey | VGJASKYKFJUINR-JMZGFNRRSA-N |
| XLogP | 2.16 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.78 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |