C13H24N2O4S — CID 154815635
S-[2-[3-[[(2R)-2-hydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyl] ethanethioate (PubChem CID 154815635) has the molecular formula C13H24N2O4S and a molecular weight of 304.41 g/mol. Its IUPAC name is S-[2-[3-[[(2R)-2-hydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyl] ethanethioate.
| Compound Name | S-[2-[3-[[(2R)-2-hydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyl] ethanethioate |
|---|---|
| PubChem CID | 154815635 |
| Molecular Formula | C13H24N2O4S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | S-[2-[3-[[(2R)-2-hydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyl] ethanethioate |
| SMILES | CC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)C |
| InChI | InChI=1S/C13H24N2O4S/c1-9(16)20-8-7-14-10(17)5-6-15-12(19)11(18)13(2,3)4/h11,18H,5-8H2,1-4H3,(H,14,17)(H,15,19)/t11-/m0/s1 |
| InChIKey | FUWDOWBZERSXSN-NSHDSACASA-N |
| XLogP | 0.30 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|