C17H24F2N2O3S — CID 154818469
N-[(3R,7S,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1-(2,4-difluorophenyl)methanesulfonamide (PubChem CID 154818469) has the molecular formula C17H24F2N2O3S and a molecular weight of 374.45 g/mol. Its IUPAC name is N-[(3R,7S,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1-(2,4-difluorophenyl)methanesulfonamide.
| Compound Name | N-[(3R,7S,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1-(2,4-difluorophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 154818469 |
| Molecular Formula | C17H24F2N2O3S |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | N-[(3R,7S,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1-(2,4-difluorophenyl)methanesulfonamide |
| SMILES | CC(C)[C@@H]1CN2C[C@@H](NS(=O)(=O)Cc3ccc(F)cc3F)C[C@H]2CO1 |
| InChI | InChI=1S/C17H24F2N2O3S/c1-11(2)17-8-21-7-14(6-15(21)9-24-17)20-25(22,23)10-12-3-4-13(18)5-16(12)19/h3-5,11,14-15,17,20H,6-10H2,1-2H3/t14-,15-,17-/m0/s1 |
| InChIKey | ZPALQTZNRMIXFH-ZOBUZTSGSA-N |
| XLogP | 1.88 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |