C20H31ClN2O3 — CID 154818980
(1S,3S,4S)-4-amino-N-[3-(2-chlorophenoxy)propyl]-N-methyl-3-propoxycyclohexane-1-carboxamide (PubChem CID 154818980) has the molecular formula C20H31ClN2O3 and a molecular weight of 382.93 g/mol. Its IUPAC name is (1S,3S,4S)-4-amino-N-[3-(2-chlorophenoxy)propyl]-N-methyl-3-propoxycyclohexane-1-carboxamide.
| Compound Name | (1S,3S,4S)-4-amino-N-[3-(2-chlorophenoxy)propyl]-N-methyl-3-propoxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 154818980 |
| Molecular Formula | C20H31ClN2O3 |
| Molecular Weight | 382.93 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (1S,3S,4S)-4-amino-N-[3-(2-chlorophenoxy)propyl]-N-methyl-3-propoxycyclohexane-1-carboxamide |
| SMILES | CCCO[C@H]1C[C@@H](C(=O)N(C)CCCOc2ccccc2Cl)CC[C@@H]1N |
| InChI | InChI=1S/C20H31ClN2O3/c1-3-12-25-19-14-15(9-10-17(19)22)20(24)23(2)11-6-13-26-18-8-5-4-7-16(18)21/h4-5,7-8,15,17,19H,3,6,9-14,22H2,1-2H3/t15-,17-,19-/m0/s1 |
| InChIKey | HKGZCXNPQNEZRX-IEZWGBDMSA-N |
| XLogP | 3.49 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.93 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|