C22H25N3O2S — CID 154820978
(1S,3S,8R)-3-phenyl-9-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-2-oxa-5,9-diazatricyclo[6.3.0.01,5]undecan-6-one (PubChem CID 154820978) has the molecular formula C22H25N3O2S and a molecular weight of 395.53 g/mol. Its IUPAC name is (1S,3S,8R)-3-phenyl-9-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-2-oxa-5,9-diazatricyclo[6.3.0.01,5]undecan-6-one.
| Compound Name | (1S,3S,8R)-3-phenyl-9-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-2-oxa-5,9-diazatricyclo[6.3.0.01,5]undecan-6-one |
|---|---|
| PubChem CID | 154820978 |
| Molecular Formula | C22H25N3O2S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | (1S,3S,8R)-3-phenyl-9-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-2-oxa-5,9-diazatricyclo[6.3.0.01,5]undecan-6-one |
| SMILES | O=C1C[C@H]2N(Cc3nc4c(s3)CCCC4)CC[C@]23O[C@@H](c2ccccc2)CN13 |
| InChI | InChI=1S/C22H25N3O2S/c26-21-12-19-22(25(21)13-17(27-22)15-6-2-1-3-7-15)10-11-24(19)14-20-23-16-8-4-5-9-18(16)28-20/h1-3,6-7,17,19H,4-5,8-14H2/t17-,19-,22+/m1/s1 |
| InChIKey | BWDSYWNNQHPCLJ-JUXOCIIHSA-N |
| XLogP | 3.30 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |