C17H25FN2O3S — CID 154822953
N-[(3R,7S,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1-(2-fluorophenyl)methanesulfonamide (PubChem CID 154822953) has the molecular formula C17H25FN2O3S and a molecular weight of 356.46 g/mol. Its IUPAC name is N-[(3R,7S,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1-(2-fluorophenyl)methanesulfonamide.
| Compound Name | N-[(3R,7S,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1-(2-fluorophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 154822953 |
| Molecular Formula | C17H25FN2O3S |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | N-[(3R,7S,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1-(2-fluorophenyl)methanesulfonamide |
| SMILES | CC(C)[C@@H]1CN2C[C@@H](NS(=O)(=O)Cc3ccccc3F)C[C@H]2CO1 |
| InChI | InChI=1S/C17H25FN2O3S/c1-12(2)17-9-20-8-14(7-15(20)10-23-17)19-24(21,22)11-13-5-3-4-6-16(13)18/h3-6,12,14-15,17,19H,7-11H2,1-2H3/t14-,15-,17-/m0/s1 |
| InChIKey | TUKZLGJRDKDXOL-ZOBUZTSGSA-N |
| XLogP | 1.74 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |