C19H23N7O — CID 154823997
6-[(4S,9aR)-4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-1-methylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 154823997) has the molecular formula C19H23N7O and a molecular weight of 365.44 g/mol. Its IUPAC name is 6-[(4S,9aR)-4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-1-methylpyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 6-[(4S,9aR)-4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-1-methylpyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 154823997 |
| Molecular Formula | C19H23N7O |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 6-[(4S,9aR)-4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-1-methylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Cn1ncc2c(N)nc(N3CCN4[C@@H](COC[C@@H]4c4ccccc4)C3)nc21 |
| InChI | InChI=1S/C19H23N7O/c1-24-18-15(9-21-24)17(20)22-19(23-18)25-7-8-26-14(10-25)11-27-12-16(26)13-5-3-2-4-6-13/h2-6,9,14,16H,7-8,10-12H2,1H3,(H2,20,22,23)/t14-,16-/m1/s1 |
| InChIKey | UKMJWCOKKJZVIE-GDBMZVCRSA-N |
| XLogP | 1.21 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |