C25H33ClN6O3 — CID 154825010
2-amino-N-[1-[[1-chloro-6-(hydrazinylmethylideneamino)-2-oxohexan-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]-3-phenylpropanamide (PubChem CID 154825010) has the molecular formula C25H33ClN6O3 and a molecular weight of 501.03 g/mol. Its IUPAC name is 2-amino-N-[1-[[1-chloro-6-(hydrazinylmethylideneamino)-2-oxohexan-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]-3-phenylpropanamide.
| Compound Name | 2-amino-N-[1-[[1-chloro-6-(hydrazinylmethylideneamino)-2-oxohexan-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 154825010 |
| Molecular Formula | C25H33ClN6O3 |
| Molecular Weight | 501.03 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | 2-amino-N-[1-[[1-chloro-6-(hydrazinylmethylideneamino)-2-oxohexan-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]-3-phenylpropanamide |
| SMILES | NN/C=N/CCCC(NC(=O)C(Cc1ccccc1)NC(=O)C(N)Cc1ccccc1)C(=O)CCl |
| InChI | InChI=1S/C25H33ClN6O3/c26-16-23(33)21(12-7-13-29-17-30-28)31-25(35)22(15-19-10-5-2-6-11-19)32-24(34)20(27)14-18-8-3-1-4-9-18/h1-6,8-11,17,20-22H,7,12-16,27-28H2,(H,29,30)(H,31,35)(H,32,34) |
| InChIKey | XBMRMPIBLTXIGW-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 151.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.03 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|