C24H31N5O6 — CID 129215787
2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(aminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 129215787) has the molecular formula C24H31N5O6 and a molecular weight of 485.54 g/mol. Its IUPAC name is 2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(aminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(aminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 129215787 |
| Molecular Formula | C24H31N5O6 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | 2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(aminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | N/C=N/CCCC(NC(=O)C(N)Cc1ccc(O)cc1)C(=O)NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C24H31N5O6/c25-14-27-11-1-2-20(28-22(32)19(26)12-15-3-7-17(30)8-4-15)23(33)29-21(24(34)35)13-16-5-9-18(31)10-6-16/h3-10,14,19-21,30-31H,1-2,11-13,26H2,(H2,25,27)(H,28,32)(H,29,33)(H,34,35) |
| InChIKey | CWSRTMYUQSXOMC-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 200.36 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|