C24H32O6 — CID 154825199
(E)-5-hydroxy-2-(2-hydroxypropyl)hex-2-enoic acid;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol (PubChem CID 154825199) has the molecular formula C24H32O6 and a molecular weight of 416.51 g/mol. Its IUPAC name is (E)-5-hydroxy-2-(2-hydroxypropyl)hex-2-enoic acid;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol.
| Compound Name | (E)-5-hydroxy-2-(2-hydroxypropyl)hex-2-enoic acid;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol |
|---|---|
| PubChem CID | 154825199 |
| Molecular Formula | C24H32O6 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | (E)-5-hydroxy-2-(2-hydroxypropyl)hex-2-enoic acid;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol |
| SMILES | CC(C)(c1ccc(O)cc1)c1ccc(O)cc1.CC(O)C/C=C(\CC(C)O)C(=O)O |
| InChI | InChI=1S/C15H16O2.C9H16O4/c1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12;1-6(10)3-4-8(9(12)13)5-7(2)11/h3-10,16-17H,1-2H3;4,6-7,10-11H,3,5H2,1-2H3,(H,12,13)/b;8-4+ |
| InChIKey | QZHMIIBQADMCHG-OVLVCPKESA-N |
| XLogP | 3.96 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|