C25H18N6OS2 — CID 15482605
(4-methyl-2-phenyl-1,3-thiazol-5-yl)-[(5Z)-4-phenyl-5-[(E)-pyridin-4-ylmethylidenehydrazinylidene]-1,3,4-thiadiazol-2-yl]methanone (PubChem CID 15482605) has the molecular formula C25H18N6OS2 and a molecular weight of 482.59 g/mol. Its IUPAC name is (4-methyl-2-phenyl-1,3-thiazol-5-yl)-[(5Z)-4-phenyl-5-[(E)-pyridin-4-ylmethylidenehydrazinylidene]-1,3,4-thiadiazol-2-yl]methanone.
| Compound Name | (4-methyl-2-phenyl-1,3-thiazol-5-yl)-[(5Z)-4-phenyl-5-[(E)-pyridin-4-ylmethylidenehydrazinylidene]-1,3,4-thiadiazol-2-yl]methanone |
|---|---|
| PubChem CID | 15482605 |
| Molecular Formula | C25H18N6OS2 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | (4-methyl-2-phenyl-1,3-thiazol-5-yl)-[(5Z)-4-phenyl-5-[(E)-pyridin-4-ylmethylidenehydrazinylidene]-1,3,4-thiadiazol-2-yl]methanone |
| SMILES | Cc1nc(-c2ccccc2)sc1C(=O)c1nn(-c2ccccc2)/c(=N/N=C/c2ccncc2)s1 |
| InChI | InChI=1S/C25H18N6OS2/c1-17-22(33-23(28-17)19-8-4-2-5-9-19)21(32)24-30-31(20-10-6-3-7-11-20)25(34-24)29-27-16-18-12-14-26-15-13-18/h2-16H,1H3/b27-16+,29-25- |
| InChIKey | YNCKFMFRXZAQMJ-VGNOKJMZSA-N |
| XLogP | 4.93 |
| TPSA | 85.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|