C8H12N2O4S — CID 154833223
N-ethyl-N-methyl-5-sulfamoylfuran-2-carboxamide (PubChem CID 154833223) has the molecular formula C8H12N2O4S and a molecular weight of 232.26 g/mol. Its IUPAC name is N-ethyl-N-methyl-5-sulfamoylfuran-2-carboxamide.
| Compound Name | N-ethyl-N-methyl-5-sulfamoylfuran-2-carboxamide |
|---|---|
| PubChem CID | 154833223 |
| Molecular Formula | C8H12N2O4S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | N-ethyl-N-methyl-5-sulfamoylfuran-2-carboxamide |
| SMILES | CCN(C)C(=O)c1ccc(S(N)(=O)=O)o1 |
| InChI | InChI=1S/C8H12N2O4S/c1-3-10(2)8(11)6-4-5-7(14-6)15(9,12)13/h4-5H,3H2,1-2H3,(H2,9,12,13) |
| InChIKey | SWNSLFVVLCAVQA-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |