C22H32N4O5 — CID 154838787
tert-butyl 3-[[methyl(2-phenoxyethyl)amino]methyl]-2,4-dioxo-1,3,9-triazaspiro[4.5]decane-9-carboxylate (PubChem CID 154838787) has the molecular formula C22H32N4O5 and a molecular weight of 432.52 g/mol. Its IUPAC name is tert-butyl 3-[[methyl(2-phenoxyethyl)amino]methyl]-2,4-dioxo-1,3,9-triazaspiro[4.5]decane-9-carboxylate.
| Compound Name | tert-butyl 3-[[methyl(2-phenoxyethyl)amino]methyl]-2,4-dioxo-1,3,9-triazaspiro[4.5]decane-9-carboxylate |
|---|---|
| PubChem CID | 154838787 |
| Molecular Formula | C22H32N4O5 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | tert-butyl 3-[[methyl(2-phenoxyethyl)amino]methyl]-2,4-dioxo-1,3,9-triazaspiro[4.5]decane-9-carboxylate |
| SMILES | CN(CCOc1ccccc1)CN1C(=O)NC2(CCCN(C(=O)OC(C)(C)C)C2)C1=O |
| InChI | InChI=1S/C22H32N4O5/c1-21(2,3)31-20(29)25-12-8-11-22(15-25)18(27)26(19(28)23-22)16-24(4)13-14-30-17-9-6-5-7-10-17/h5-7,9-10H,8,11-16H2,1-4H3,(H,23,28) |
| InChIKey | ICSGFURLYACHSE-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|