C19H19N5 — CID 154841280
N-(2-phenylcyclopentyl)-4-pyrazin-2-ylpyrimidin-2-amine (PubChem CID 154841280) has the molecular formula C19H19N5 and a molecular weight of 317.40 g/mol. Its IUPAC name is N-(2-phenylcyclopentyl)-4-pyrazin-2-ylpyrimidin-2-amine.
| Compound Name | N-(2-phenylcyclopentyl)-4-pyrazin-2-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 154841280 |
| Molecular Formula | C19H19N5 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | N-(2-phenylcyclopentyl)-4-pyrazin-2-ylpyrimidin-2-amine |
| SMILES | c1ccc(C2CCCC2Nc2nccc(-c3cnccn3)n2)cc1 |
| InChI | InChI=1S/C19H19N5/c1-2-5-14(6-3-1)15-7-4-8-16(15)23-19-22-10-9-17(24-19)18-13-20-11-12-21-18/h1-3,5-6,9-13,15-16H,4,7-8H2,(H,22,23,24) |
| InChIKey | JYMGUFIUBOFJBM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |