C18H23N5O2 — CID 154844070
5-[(3-pyrrolidin-1-ylpyrrolidine-1-carbonyl)amino]-1H-indole-2-carboxamide (PubChem CID 154844070) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is 5-[(3-pyrrolidin-1-ylpyrrolidine-1-carbonyl)amino]-1H-indole-2-carboxamide.
| Compound Name | 5-[(3-pyrrolidin-1-ylpyrrolidine-1-carbonyl)amino]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 154844070 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 5-[(3-pyrrolidin-1-ylpyrrolidine-1-carbonyl)amino]-1H-indole-2-carboxamide |
| SMILES | NC(=O)c1cc2cc(NC(=O)N3CCC(N4CCCC4)C3)ccc2[nH]1 |
| InChI | InChI=1S/C18H23N5O2/c19-17(24)16-10-12-9-13(3-4-15(12)21-16)20-18(25)23-8-5-14(11-23)22-6-1-2-7-22/h3-4,9-10,14,21H,1-2,5-8,11H2,(H2,19,24)(H,20,25) |
| InChIKey | AFCBBXTYSJJHRO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |