C11H10F3N5O — CID 154844252
3,3,3-trifluoro-N-[3-(2H-tetrazol-5-ylmethyl)phenyl]propanamide (PubChem CID 154844252) has the molecular formula C11H10F3N5O and a molecular weight of 285.23 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-[3-(2H-tetrazol-5-ylmethyl)phenyl]propanamide.
| Compound Name | 3,3,3-trifluoro-N-[3-(2H-tetrazol-5-ylmethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 154844252 |
| Molecular Formula | C11H10F3N5O |
| Molecular Weight | 285.23 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 3,3,3-trifluoro-N-[3-(2H-tetrazol-5-ylmethyl)phenyl]propanamide |
| SMILES | O=C(CC(F)(F)F)Nc1cccc(Cc2nn[nH]n2)c1 |
| InChI | InChI=1S/C11H10F3N5O/c12-11(13,14)6-10(20)15-8-3-1-2-7(4-8)5-9-16-18-19-17-9/h1-4H,5-6H2,(H,15,20)(H,16,17,18,19) |
| InChIKey | LIRQBXJJHGZARM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.23 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |