About N-(6-methoxy-2-oxo-3,4-dihydro-1H-quinolin-7-yl)-2-(2-methylphenyl)benzamide
N-(6-methoxy-2-oxo-3,4-dihydro-1H-quinolin-7-yl)-2-(2-methylphenyl)benzamide (PubChem CID 154850511) has the molecular formula C24H22N2O3
and a molecular weight of 386.45 g/mol. Its IUPAC name is N-(6-methoxy-2-oxo-3,4-dihydro-1H-quinolin-7-yl)-2-(2-methylphenyl)benzamide.
Molecular Properties
| Compound Name | N-(6-methoxy-2-oxo-3,4-dihydro-1H-quinolin-7-yl)-2-(2-methylphenyl)benzamide |
| PubChem CID | 154850511 |
| Molecular Formula | C24H22N2O3 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | N-(6-methoxy-2-oxo-3,4-dihydro-1H-quinolin-7-yl)-2-(2-methylphenyl)benzamide |
| SMILES | COc1cc2c(cc1NC(=O)c1ccccc1-c1ccccc1C)NC(=O)CC2 |
| InChI | InChI=1S/C24H22N2O3/c1-15-7-3-4-8-17(15)18-9-5-6-10-19(18)24(28)26-21-14-20-16(13-22(21)29-2)11-12-23(27)25-20/h3-10,13-14H,11-12H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | YTCXLTXGVSILGU-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(6-methoxy-2-oxo-3,4-dihydro-1H-quinolin-7-yl)-2-(2-methylphenyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-methoxy-2-oxo-3,4-dihydro-1H-quinolin-7-yl)-2-(2-methylphenyl)benzamide?
The IUPAC name of N-(6-methoxy-2-oxo-3,4-dihydro-1H-quinolin-7-yl)-2-(2-methylphenyl)benzamide (CID 154850511) is N-(6-methoxy-2-oxo-3,4-dihydro-1H-quinolin-7-yl)-2-(2-methylphenyl)benzamide.
What is the SMILES notation for N-(6-methoxy-2-oxo-3,4-dihydro-1H-quinolin-7-yl)-2-(2-methylphenyl)benzamide?
The canonical SMILES for N-(6-methoxy-2-oxo-3,4-dihydro-1H-quinolin-7-yl)-2-(2-methylphenyl)benzamide is COc1cc2c(cc1NC(=O)c1ccccc1-c1ccccc1C)NC(=O)CC2.
What is the InChIKey of N-(6-methoxy-2-oxo-3,4-dihydro-1H-quinolin-7-yl)-2-(2-methylphenyl)benzamide?
The InChIKey is YTCXLTXGVSILGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N2O3/c1-15-7-3-4-8-17(15)18-9-5-6-10-19(18)24(28)26-21-14-20-16(13-22(21)29-2)11-12-23(27)25-20/h3-10,13-14H,11-12H2,1-2H3,(H,25,27)(H,26,28).
What are the key properties of N-(6-methoxy-2-oxo-3,4-dihydro-1H-quinolin-7-yl)-2-(2-methylphenyl)benzamide?
N-(6-methoxy-2-oxo-3,4-dihydro-1H-quinolin-7-yl)-2-(2-methylphenyl)benzamide has a molecular weight of 386.45 g/mol, XLogP of 4.81, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-methoxy-2-oxo-3,4-dihydro-1H-quinolin-7-yl)-2-(2-methylphenyl)benzamide is sourced from PubChem (CID 154850511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).