C23H20F3N3O3 — CID 154852591
3-methyl-4-[4-[3-(trifluoromethyl)benzoyl]piperazine-1-carbonyl]-1H-quinolin-2-one (PubChem CID 154852591) has the molecular formula C23H20F3N3O3 and a molecular weight of 443.43 g/mol. Its IUPAC name is 3-methyl-4-[4-[3-(trifluoromethyl)benzoyl]piperazine-1-carbonyl]-1H-quinolin-2-one.
| Compound Name | 3-methyl-4-[4-[3-(trifluoromethyl)benzoyl]piperazine-1-carbonyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 154852591 |
| Molecular Formula | C23H20F3N3O3 |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 3-methyl-4-[4-[3-(trifluoromethyl)benzoyl]piperazine-1-carbonyl]-1H-quinolin-2-one |
| SMILES | Cc1c(C(=O)N2CCN(C(=O)c3cccc(C(F)(F)F)c3)CC2)c2ccccc2[nH]c1=O |
| InChI | InChI=1S/C23H20F3N3O3/c1-14-19(17-7-2-3-8-18(17)27-20(14)30)22(32)29-11-9-28(10-12-29)21(31)15-5-4-6-16(13-15)23(24,25)26/h2-8,13H,9-12H2,1H3,(H,27,30) |
| InChIKey | UPDLORHHJRIWHX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |