C15H18FN5O2S — CID 154855923
3-fluoro-N-[3-[4-(2H-triazol-4-yl)butanoylamino]cyclobutyl]thiophene-2-carboxamide (PubChem CID 154855923) has the molecular formula C15H18FN5O2S and a molecular weight of 351.41 g/mol. Its IUPAC name is 3-fluoro-N-[3-[4-(2H-triazol-4-yl)butanoylamino]cyclobutyl]thiophene-2-carboxamide.
| Compound Name | 3-fluoro-N-[3-[4-(2H-triazol-4-yl)butanoylamino]cyclobutyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 154855923 |
| Molecular Formula | C15H18FN5O2S |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 3-fluoro-N-[3-[4-(2H-triazol-4-yl)butanoylamino]cyclobutyl]thiophene-2-carboxamide |
| SMILES | O=C(CCCc1cn[nH]n1)NC1CC(NC(=O)c2sccc2F)C1 |
| InChI | InChI=1S/C15H18FN5O2S/c16-12-4-5-24-14(12)15(23)19-11-6-10(7-11)18-13(22)3-1-2-9-8-17-21-20-9/h4-5,8,10-11H,1-3,6-7H2,(H,18,22)(H,19,23)(H,17,20,21) |
| InChIKey | NMIYFXJUHQXYEV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |