C17H13ClN2O5S2 — CID 154857541
ethyl 6-[[(2-chloro-4-nitrobenzoyl)amino]methyl]thieno[3,2-b]thiophene-5-carboxylate (PubChem CID 154857541) has the molecular formula C17H13ClN2O5S2 and a molecular weight of 424.89 g/mol. Its IUPAC name is ethyl 6-[[(2-chloro-4-nitrobenzoyl)amino]methyl]thieno[3,2-b]thiophene-5-carboxylate.
| Compound Name | ethyl 6-[[(2-chloro-4-nitrobenzoyl)amino]methyl]thieno[3,2-b]thiophene-5-carboxylate |
|---|---|
| PubChem CID | 154857541 |
| Molecular Formula | C17H13ClN2O5S2 |
| Molecular Weight | 424.89 g/mol |
| Exact Mass | 424.00 |
| IUPAC Name | ethyl 6-[[(2-chloro-4-nitrobenzoyl)amino]methyl]thieno[3,2-b]thiophene-5-carboxylate |
| SMILES | CCOC(=O)c1sc2ccsc2c1CNC(=O)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C17H13ClN2O5S2/c1-2-25-17(22)15-11(14-13(27-15)5-6-26-14)8-19-16(21)10-4-3-9(20(23)24)7-12(10)18/h3-7H,2,8H2,1H3,(H,19,21) |
| InChIKey | JZSLWLQJCHXCAB-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.89 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|