C22H24N4O4S2 — CID 154857902
1-(5-benzyl-1,3-thiazol-2-yl)-3-[(2-morpholin-4-ylsulfonylphenyl)methyl]urea (PubChem CID 154857902) has the molecular formula C22H24N4O4S2 and a molecular weight of 472.59 g/mol. Its IUPAC name is 1-(5-benzyl-1,3-thiazol-2-yl)-3-[(2-morpholin-4-ylsulfonylphenyl)methyl]urea.
| Compound Name | 1-(5-benzyl-1,3-thiazol-2-yl)-3-[(2-morpholin-4-ylsulfonylphenyl)methyl]urea |
|---|---|
| PubChem CID | 154857902 |
| Molecular Formula | C22H24N4O4S2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | 1-(5-benzyl-1,3-thiazol-2-yl)-3-[(2-morpholin-4-ylsulfonylphenyl)methyl]urea |
| SMILES | O=C(NCc1ccccc1S(=O)(=O)N1CCOCC1)Nc1ncc(Cc2ccccc2)s1 |
| InChI | InChI=1S/C22H24N4O4S2/c27-21(25-22-24-16-19(31-22)14-17-6-2-1-3-7-17)23-15-18-8-4-5-9-20(18)32(28,29)26-10-12-30-13-11-26/h1-9,16H,10-15H2,(H2,23,24,25,27) |
| InChIKey | WCYRQXMQBFEBLP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |