C26H28N2O5 — CID 154859716
3-[benzyl-[2-[(6-oxo-8,9,10,11-tetrahydro-7H-cyclohepta[c]chromen-3-yl)oxy]acetyl]amino]propanamide (PubChem CID 154859716) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is 3-[benzyl-[2-[(6-oxo-8,9,10,11-tetrahydro-7H-cyclohepta[c]chromen-3-yl)oxy]acetyl]amino]propanamide.
| Compound Name | 3-[benzyl-[2-[(6-oxo-8,9,10,11-tetrahydro-7H-cyclohepta[c]chromen-3-yl)oxy]acetyl]amino]propanamide |
|---|---|
| PubChem CID | 154859716 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 3-[benzyl-[2-[(6-oxo-8,9,10,11-tetrahydro-7H-cyclohepta[c]chromen-3-yl)oxy]acetyl]amino]propanamide |
| SMILES | NC(=O)CCN(Cc1ccccc1)C(=O)COc1ccc2c3c(c(=O)oc2c1)CCCCC3 |
| InChI | InChI=1S/C26H28N2O5/c27-24(29)13-14-28(16-18-7-3-1-4-8-18)25(30)17-32-19-11-12-21-20-9-5-2-6-10-22(20)26(31)33-23(21)15-19/h1,3-4,7-8,11-12,15H,2,5-6,9-10,13-14,16-17H2,(H2,27,29) |
| InChIKey | GKOKFORCHPCSAJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|