C24H28N4O4 — CID 154862512
6-[1-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carbonyl)piperidine-4-carbonyl]-2-methyl-4H-1,4-benzoxazin-3-one (PubChem CID 154862512) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is 6-[1-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carbonyl)piperidine-4-carbonyl]-2-methyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[1-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carbonyl)piperidine-4-carbonyl]-2-methyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 154862512 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 6-[1-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carbonyl)piperidine-4-carbonyl]-2-methyl-4H-1,4-benzoxazin-3-one |
| SMILES | CC1Oc2ccc(C(=O)C3CCN(C(=O)c4n[nH]c5c4CCCCC5)CC3)cc2NC1=O |
| InChI | InChI=1S/C24H28N4O4/c1-14-23(30)25-19-13-16(7-8-20(19)32-14)22(29)15-9-11-28(12-10-15)24(31)21-17-5-3-2-4-6-18(17)26-27-21/h7-8,13-15H,2-6,9-12H2,1H3,(H,25,30)(H,26,27) |
| InChIKey | RBFWNZNWRCSIFV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |