C16H23ClN4O3S — CID 154865881
3-[3-(3-chloroanilino)pyrrolidine-1-carbonyl]piperidine-1-sulfonamide (PubChem CID 154865881) has the molecular formula C16H23ClN4O3S and a molecular weight of 386.91 g/mol. Its IUPAC name is 3-[3-(3-chloroanilino)pyrrolidine-1-carbonyl]piperidine-1-sulfonamide.
| Compound Name | 3-[3-(3-chloroanilino)pyrrolidine-1-carbonyl]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 154865881 |
| Molecular Formula | C16H23ClN4O3S |
| Molecular Weight | 386.91 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 3-[3-(3-chloroanilino)pyrrolidine-1-carbonyl]piperidine-1-sulfonamide |
| SMILES | NS(=O)(=O)N1CCCC(C(=O)N2CCC(Nc3cccc(Cl)c3)C2)C1 |
| InChI | InChI=1S/C16H23ClN4O3S/c17-13-4-1-5-14(9-13)19-15-6-8-20(11-15)16(22)12-3-2-7-21(10-12)25(18,23)24/h1,4-5,9,12,15,19H,2-3,6-8,10-11H2,(H2,18,23,24) |
| InChIKey | IPTTURWZEIQNCM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.91 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |