C17H18F3N3O4 — CID 154865951
4-[2-[2-methyl-6-(2,2,2-trifluoroethyl)morpholin-4-yl]-2-oxoethyl]-1H-quinoxaline-2,3-dione (PubChem CID 154865951) has the molecular formula C17H18F3N3O4 and a molecular weight of 385.34 g/mol. Its IUPAC name is 4-[2-[2-methyl-6-(2,2,2-trifluoroethyl)morpholin-4-yl]-2-oxoethyl]-1H-quinoxaline-2,3-dione.
| Compound Name | 4-[2-[2-methyl-6-(2,2,2-trifluoroethyl)morpholin-4-yl]-2-oxoethyl]-1H-quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 154865951 |
| Molecular Formula | C17H18F3N3O4 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 4-[2-[2-methyl-6-(2,2,2-trifluoroethyl)morpholin-4-yl]-2-oxoethyl]-1H-quinoxaline-2,3-dione |
| SMILES | CC1CN(C(=O)Cn2c(=O)c(=O)[nH]c3ccccc32)CC(CC(F)(F)F)O1 |
| InChI | InChI=1S/C17H18F3N3O4/c1-10-7-22(8-11(27-10)6-17(18,19)20)14(24)9-23-13-5-3-2-4-12(13)21-15(25)16(23)26/h2-5,10-11H,6-9H2,1H3,(H,21,25) |
| InChIKey | GQEYJXYMJGYBML-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 84.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|