C22H27N3O2 — CID 154866213
(3aS,6aR)-3-[1-(2-naphthalen-2-ylethyl)piperidin-4-yl]-4,5,6,6a-tetrahydro-3aH-pyrrolo[3,4-d][1,3]oxazol-2-one (PubChem CID 154866213) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is (3aS,6aR)-3-[1-(2-naphthalen-2-ylethyl)piperidin-4-yl]-4,5,6,6a-tetrahydro-3aH-pyrrolo[3,4-d][1,3]oxazol-2-one.
| Compound Name | (3aS,6aR)-3-[1-(2-naphthalen-2-ylethyl)piperidin-4-yl]-4,5,6,6a-tetrahydro-3aH-pyrrolo[3,4-d][1,3]oxazol-2-one |
|---|---|
| PubChem CID | 154866213 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | (3aS,6aR)-3-[1-(2-naphthalen-2-ylethyl)piperidin-4-yl]-4,5,6,6a-tetrahydro-3aH-pyrrolo[3,4-d][1,3]oxazol-2-one |
| SMILES | O=C1O[C@@H]2CNC[C@@H]2N1C1CCN(CCc2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C22H27N3O2/c26-22-25(20-14-23-15-21(20)27-22)19-8-11-24(12-9-19)10-7-16-5-6-17-3-1-2-4-18(17)13-16/h1-6,13,19-21,23H,7-12,14-15H2/t20-,21+/m0/s1 |
| InChIKey | YLIIJZJXIHBSKV-LEWJYISDSA-N |
| XLogP | 2.64 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |