C17H18FN3O3 — CID 154867887
N-[4-(3-fluorophenyl)-4-hydroxycyclohexyl]-4-oxo-1H-pyridazine-5-carboxamide (PubChem CID 154867887) has the molecular formula C17H18FN3O3 and a molecular weight of 331.35 g/mol. Its IUPAC name is N-[4-(3-fluorophenyl)-4-hydroxycyclohexyl]-4-oxo-1H-pyridazine-5-carboxamide.
| Compound Name | N-[4-(3-fluorophenyl)-4-hydroxycyclohexyl]-4-oxo-1H-pyridazine-5-carboxamide |
|---|---|
| PubChem CID | 154867887 |
| Molecular Formula | C17H18FN3O3 |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | N-[4-(3-fluorophenyl)-4-hydroxycyclohexyl]-4-oxo-1H-pyridazine-5-carboxamide |
| SMILES | O=C(NC1CCC(O)(c2cccc(F)c2)CC1)c1c[nH]ncc1=O |
| InChI | InChI=1S/C17H18FN3O3/c18-12-3-1-2-11(8-12)17(24)6-4-13(5-7-17)21-16(23)14-9-19-20-10-15(14)22/h1-3,8-10,13,24H,4-7H2,(H,19,22)(H,21,23) |
| InChIKey | YNVAUMTZTWMFFM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |