C16H21N3O3 — CID 154869696
N-[2-(2-oxopyrrolidin-1-yl)ethoxy]-5,6,7,8-tetrahydroquinoline-5-carboxamide (PubChem CID 154869696) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is N-[2-(2-oxopyrrolidin-1-yl)ethoxy]-5,6,7,8-tetrahydroquinoline-5-carboxamide.
| Compound Name | N-[2-(2-oxopyrrolidin-1-yl)ethoxy]-5,6,7,8-tetrahydroquinoline-5-carboxamide |
|---|---|
| PubChem CID | 154869696 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | N-[2-(2-oxopyrrolidin-1-yl)ethoxy]-5,6,7,8-tetrahydroquinoline-5-carboxamide |
| SMILES | O=C(NOCCN1CCCC1=O)C1CCCc2ncccc21 |
| InChI | InChI=1S/C16H21N3O3/c20-15-7-3-9-19(15)10-11-22-18-16(21)13-4-1-6-14-12(13)5-2-8-17-14/h2,5,8,13H,1,3-4,6-7,9-11H2,(H,18,21) |
| InChIKey | JYODHDHGXJEPHG-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|