C16H17FN2O — CID 154870028
(3S,4S)-4-fluoro-N-[(3-pyridin-2-ylphenyl)methyl]oxolan-3-amine (PubChem CID 154870028) has the molecular formula C16H17FN2O and a molecular weight of 272.32 g/mol. Its IUPAC name is (3S,4S)-4-fluoro-N-[(3-pyridin-2-ylphenyl)methyl]oxolan-3-amine.
| Compound Name | (3S,4S)-4-fluoro-N-[(3-pyridin-2-ylphenyl)methyl]oxolan-3-amine |
|---|---|
| PubChem CID | 154870028 |
| Molecular Formula | C16H17FN2O |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | (3S,4S)-4-fluoro-N-[(3-pyridin-2-ylphenyl)methyl]oxolan-3-amine |
| SMILES | F[C@@H]1COC[C@@H]1NCc1cccc(-c2ccccn2)c1 |
| InChI | InChI=1S/C16H17FN2O/c17-14-10-20-11-16(14)19-9-12-4-3-5-13(8-12)15-6-1-2-7-18-15/h1-8,14,16,19H,9-11H2/t14-,16+/m1/s1 |
| InChIKey | SDLCEHNWGDSWMN-ZBFHGGJFSA-N |
| XLogP | 2.58 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |