C20H19N5O2S — CID 154874344
N-[2-[[4-(thiadiazol-4-yl)benzoyl]amino]phenyl]pyrrolidine-1-carboxamide (PubChem CID 154874344) has the molecular formula C20H19N5O2S and a molecular weight of 393.47 g/mol. Its IUPAC name is N-[2-[[4-(thiadiazol-4-yl)benzoyl]amino]phenyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[2-[[4-(thiadiazol-4-yl)benzoyl]amino]phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 154874344 |
| Molecular Formula | C20H19N5O2S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | N-[2-[[4-(thiadiazol-4-yl)benzoyl]amino]phenyl]pyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1NC(=O)N1CCCC1)c1ccc(-c2csnn2)cc1 |
| InChI | InChI=1S/C20H19N5O2S/c26-19(15-9-7-14(8-10-15)18-13-28-24-23-18)21-16-5-1-2-6-17(16)22-20(27)25-11-3-4-12-25/h1-2,5-10,13H,3-4,11-12H2,(H,21,26)(H,22,27) |
| InChIKey | KTNMIFBZJVKATK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |