C18H23Cl2N3O3 — CID 154874985
N-[2-[(2-chloroacetyl)amino]ethyl]-N-[(3-chlorophenyl)methyl]-2,2-dimethyl-5-oxopyrrolidine-3-carboxamide (PubChem CID 154874985) has the molecular formula C18H23Cl2N3O3 and a molecular weight of 400.31 g/mol. Its IUPAC name is N-[2-[(2-chloroacetyl)amino]ethyl]-N-[(3-chlorophenyl)methyl]-2,2-dimethyl-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[2-[(2-chloroacetyl)amino]ethyl]-N-[(3-chlorophenyl)methyl]-2,2-dimethyl-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 154874985 |
| Molecular Formula | C18H23Cl2N3O3 |
| Molecular Weight | 400.31 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | N-[2-[(2-chloroacetyl)amino]ethyl]-N-[(3-chlorophenyl)methyl]-2,2-dimethyl-5-oxopyrrolidine-3-carboxamide |
| SMILES | CC1(C)NC(=O)CC1C(=O)N(CCNC(=O)CCl)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H23Cl2N3O3/c1-18(2)14(9-15(24)22-18)17(26)23(7-6-21-16(25)10-19)11-12-4-3-5-13(20)8-12/h3-5,8,14H,6-7,9-11H2,1-2H3,(H,21,25)(H,22,24) |
| InChIKey | FHMLMNQQIZRUBZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|