C19H17Cl2N3O2S — CID 154875064
N-[2-[(2-chloroacetyl)amino]ethyl]-N-[(3-chlorophenyl)methyl]-1,3-benzothiazole-2-carboxamide (PubChem CID 154875064) has the molecular formula C19H17Cl2N3O2S and a molecular weight of 422.34 g/mol. Its IUPAC name is N-[2-[(2-chloroacetyl)amino]ethyl]-N-[(3-chlorophenyl)methyl]-1,3-benzothiazole-2-carboxamide.
| Compound Name | N-[2-[(2-chloroacetyl)amino]ethyl]-N-[(3-chlorophenyl)methyl]-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 154875064 |
| Molecular Formula | C19H17Cl2N3O2S |
| Molecular Weight | 422.34 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | N-[2-[(2-chloroacetyl)amino]ethyl]-N-[(3-chlorophenyl)methyl]-1,3-benzothiazole-2-carboxamide |
| SMILES | O=C(CCl)NCCN(Cc1cccc(Cl)c1)C(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H17Cl2N3O2S/c20-11-17(25)22-8-9-24(12-13-4-3-5-14(21)10-13)19(26)18-23-15-6-1-2-7-16(15)27-18/h1-7,10H,8-9,11-12H2,(H,22,25) |
| InChIKey | HELOHFYQRIQFJN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|