C14H18ClNO3 — CID 91662725
(2S)-N-[(3-chlorophenyl)methyl]-N-(2-hydroxyethyl)oxolane-2-carboxamide (PubChem CID 91662725) has the molecular formula C14H18ClNO3 and a molecular weight of 283.75 g/mol. Its IUPAC name is (2S)-N-[(3-chlorophenyl)methyl]-N-(2-hydroxyethyl)oxolane-2-carboxamide.
| Compound Name | (2S)-N-[(3-chlorophenyl)methyl]-N-(2-hydroxyethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 91662725 |
| Molecular Formula | C14H18ClNO3 |
| Molecular Weight | 283.75 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (2S)-N-[(3-chlorophenyl)methyl]-N-(2-hydroxyethyl)oxolane-2-carboxamide |
| SMILES | O=C([C@@H]1CCCO1)N(CCO)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H18ClNO3/c15-12-4-1-3-11(9-12)10-16(6-7-17)14(18)13-5-2-8-19-13/h1,3-4,9,13,17H,2,5-8,10H2/t13-/m0/s1 |
| InChIKey | YUPCPCBLVSWPFX-ZDUSSCGKSA-N |
| XLogP | 1.84 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.75 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |