C18H22N2O6S2 — CID 154876704
2-methoxy-5-methylsulfonyl-N-[(2S,3R)-2-pyridin-4-yloxan-3-yl]benzenesulfonamide (PubChem CID 154876704) has the molecular formula C18H22N2O6S2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 2-methoxy-5-methylsulfonyl-N-[(2S,3R)-2-pyridin-4-yloxan-3-yl]benzenesulfonamide.
| Compound Name | 2-methoxy-5-methylsulfonyl-N-[(2S,3R)-2-pyridin-4-yloxan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 154876704 |
| Molecular Formula | C18H22N2O6S2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 2-methoxy-5-methylsulfonyl-N-[(2S,3R)-2-pyridin-4-yloxan-3-yl]benzenesulfonamide |
| SMILES | COc1ccc(S(C)(=O)=O)cc1S(=O)(=O)N[C@@H]1CCCO[C@H]1c1ccncc1 |
| InChI | InChI=1S/C18H22N2O6S2/c1-25-16-6-5-14(27(2,21)22)12-17(16)28(23,24)20-15-4-3-11-26-18(15)13-7-9-19-10-8-13/h5-10,12,15,18,20H,3-4,11H2,1-2H3/t15-,18+/m1/s1 |
| InChIKey | NMSWKJSOKFNAOU-QAPCUYQASA-N |
| XLogP | 1.69 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |