C18H26Cl2N6O — CID 154888756
3-[[(2-amino-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-yl)amino]methyl]-N,N-dimethylbenzamide;dihydrochloride (PubChem CID 154888756) has the molecular formula C18H26Cl2N6O and a molecular weight of 413.35 g/mol. Its IUPAC name is 3-[[(2-amino-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-yl)amino]methyl]-N,N-dimethylbenzamide;dihydrochloride.
| Compound Name | 3-[[(2-amino-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-yl)amino]methyl]-N,N-dimethylbenzamide;dihydrochloride |
|---|---|
| PubChem CID | 154888756 |
| Molecular Formula | C18H26Cl2N6O |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 3-[[(2-amino-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-yl)amino]methyl]-N,N-dimethylbenzamide;dihydrochloride |
| SMILES | CN(C)C(=O)c1cccc(CNc2nc(N)nc3c2CCNCC3)c1.Cl.Cl |
| InChI | InChI=1S/C18H24N6O.2ClH/c1-24(2)17(25)13-5-3-4-12(10-13)11-21-16-14-6-8-20-9-7-15(14)22-18(19)23-16;;/h3-5,10,20H,6-9,11H2,1-2H3,(H3,19,21,22,23);2*1H |
| InChIKey | NARKBHJRTKIDQE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |