C19H35Cl2N5OS — CID 154898545
(2S)-2-amino-N-[(5-cyclohexyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]-4-methylsulfanylbutanamide;dihydrochloride (PubChem CID 154898545) has the molecular formula C19H35Cl2N5OS and a molecular weight of 452.50 g/mol. Its IUPAC name is (2S)-2-amino-N-[(5-cyclohexyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]-4-methylsulfanylbutanamide;dihydrochloride.
| Compound Name | (2S)-2-amino-N-[(5-cyclohexyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]-4-methylsulfanylbutanamide;dihydrochloride |
|---|---|
| PubChem CID | 154898545 |
| Molecular Formula | C19H35Cl2N5OS |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | (2S)-2-amino-N-[(5-cyclohexyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]-4-methylsulfanylbutanamide;dihydrochloride |
| SMILES | CSCC[C@H](N)C(=O)NCc1cc2n(n1)CCCN(C1CCCCC1)C2.Cl.Cl |
| InChI | InChI=1S/C19H33N5OS.2ClH/c1-26-11-8-18(20)19(25)21-13-15-12-17-14-23(9-5-10-24(17)22-15)16-6-3-2-4-7-16;;/h12,16,18H,2-11,13-14,20H2,1H3,(H,21,25);2*1H/t18-;;/m0../s1 |
| InChIKey | NHJGPHOHSNUFRY-NTEVMMBTSA-N |
| XLogP | 2.96 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |