C21H30N6O — CID 72881408
N-[(5-cyclohexyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]-2-(methylamino)pyridine-4-carboxamide (PubChem CID 72881408) has the molecular formula C21H30N6O and a molecular weight of 382.51 g/mol. Its IUPAC name is N-[(5-cyclohexyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]-2-(methylamino)pyridine-4-carboxamide.
| Compound Name | N-[(5-cyclohexyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]-2-(methylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 72881408 |
| Molecular Formula | C21H30N6O |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | N-[(5-cyclohexyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]-2-(methylamino)pyridine-4-carboxamide |
| SMILES | CNc1cc(C(=O)NCc2cc3n(n2)CCCN(C2CCCCC2)C3)ccn1 |
| InChI | InChI=1S/C21H30N6O/c1-22-20-12-16(8-9-23-20)21(28)24-14-17-13-19-15-26(10-5-11-27(19)25-17)18-6-3-2-4-7-18/h8-9,12-13,18H,2-7,10-11,14-15H2,1H3,(H,22,23)(H,24,28) |
| InChIKey | AUJISBZCQQZXHX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |