C22H30N4O — CID 70742620
N-[(5-cyclohexyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]-4-methylbenzamide (PubChem CID 70742620) has the molecular formula C22H30N4O and a molecular weight of 366.51 g/mol. Its IUPAC name is N-[(5-cyclohexyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]-4-methylbenzamide.
| Compound Name | N-[(5-cyclohexyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 70742620 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | N-[(5-cyclohexyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCc2cc3n(n2)CCCN(C2CCCCC2)C3)cc1 |
| InChI | InChI=1S/C22H30N4O/c1-17-8-10-18(11-9-17)22(27)23-15-19-14-21-16-25(12-5-13-26(21)24-19)20-6-3-2-4-7-20/h8-11,14,20H,2-7,12-13,15-16H2,1H3,(H,23,27) |
| InChIKey | HCPJIJNUONQXRJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |