C20H29N5O2 — CID 70715178
N-[(5-cyclohexyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]-3,5-dimethyl-1,2-oxazole-4-carboxamide (PubChem CID 70715178) has the molecular formula C20H29N5O2 and a molecular weight of 371.49 g/mol. Its IUPAC name is N-[(5-cyclohexyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]-3,5-dimethyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[(5-cyclohexyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]-3,5-dimethyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 70715178 |
| Molecular Formula | C20H29N5O2 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | N-[(5-cyclohexyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]-3,5-dimethyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1noc(C)c1C(=O)NCc1cc2n(n1)CCCN(C1CCCCC1)C2 |
| InChI | InChI=1S/C20H29N5O2/c1-14-19(15(2)27-23-14)20(26)21-12-16-11-18-13-24(9-6-10-25(18)22-16)17-7-4-3-5-8-17/h11,17H,3-10,12-13H2,1-2H3,(H,21,26) |
| InChIKey | BVFLDFKFZQJQLJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |