C15H22Cl2N4 — CID 154905678
1-[[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]methyl]-3-methylimidazo[1,5-a]pyridine;dihydrochloride (PubChem CID 154905678) has the molecular formula C15H22Cl2N4 and a molecular weight of 329.28 g/mol. Its IUPAC name is 1-[[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]methyl]-3-methylimidazo[1,5-a]pyridine;dihydrochloride.
| Compound Name | 1-[[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]methyl]-3-methylimidazo[1,5-a]pyridine;dihydrochloride |
|---|---|
| PubChem CID | 154905678 |
| Molecular Formula | C15H22Cl2N4 |
| Molecular Weight | 329.28 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 1-[[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]methyl]-3-methylimidazo[1,5-a]pyridine;dihydrochloride |
| SMILES | Cc1nc(CN2CC[C@H]3CNC[C@H]32)c2ccccn12.Cl.Cl |
| InChI | InChI=1S/C15H20N4.2ClH/c1-11-17-13(14-4-2-3-6-19(11)14)10-18-7-5-12-8-16-9-15(12)18;;/h2-4,6,12,15-16H,5,7-10H2,1H3;2*1H/t12-,15+;;/m0../s1 |
| InChIKey | SNRZZWQANSVOJK-XQFYMRMDSA-N |
| XLogP | 2.28 |
| TPSA | 32.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |