C25H36N2OSi — CID 140943972
3-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]propoxy-tert-butyl-diphenylsilane (PubChem CID 140943972) has the molecular formula C25H36N2OSi and a molecular weight of 408.66 g/mol. Its IUPAC name is 3-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]propoxy-tert-butyl-diphenylsilane.
| Compound Name | 3-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]propoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 140943972 |
| Molecular Formula | C25H36N2OSi |
| Molecular Weight | 408.66 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | 3-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]propoxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCCCN1CC[C@H]2CNC[C@H]21)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H36N2OSi/c1-25(2,3)29(22-11-6-4-7-12-22,23-13-8-5-9-14-23)28-18-10-16-27-17-15-21-19-26-20-24(21)27/h4-9,11-14,21,24,26H,10,15-20H2,1-3H3/t21-,24+/m0/s1 |
| InChIKey | WBRLQDGYQGIBBD-XUZZJYLKSA-N |
| XLogP | 3.25 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.66 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|