C26H36N2OSi — CID 175749325
3-(2,3,3a,4,5,6-hexahydropyrrolo[2,3-c]pyridin-1-yl)propoxy-tert-butyl-diphenylsilane (PubChem CID 175749325) has the molecular formula C26H36N2OSi and a molecular weight of 420.67 g/mol. Its IUPAC name is 3-(2,3,3a,4,5,6-hexahydropyrrolo[2,3-c]pyridin-1-yl)propoxy-tert-butyl-diphenylsilane.
| Compound Name | 3-(2,3,3a,4,5,6-hexahydropyrrolo[2,3-c]pyridin-1-yl)propoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 175749325 |
| Molecular Formula | C26H36N2OSi |
| Molecular Weight | 420.67 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | 3-(2,3,3a,4,5,6-hexahydropyrrolo[2,3-c]pyridin-1-yl)propoxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCCCN1CCC2CCNC=C21)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H36N2OSi/c1-26(2,3)30(23-11-6-4-7-12-23,24-13-8-5-9-14-24)29-20-10-18-28-19-16-22-15-17-27-21-25(22)28/h4-9,11-14,21-22,27H,10,15-20H2,1-3H3 |
| InChIKey | OPNGSONHGMFJHV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.67 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|