C15H21Cl3N4 — CID 154896453
3-[[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]methyl]-4-chloro-1-methylindazole;dihydrochloride (PubChem CID 154896453) has the molecular formula C15H21Cl3N4 and a molecular weight of 363.72 g/mol. Its IUPAC name is 3-[[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]methyl]-4-chloro-1-methylindazole;dihydrochloride.
| Compound Name | 3-[[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]methyl]-4-chloro-1-methylindazole;dihydrochloride |
|---|---|
| PubChem CID | 154896453 |
| Molecular Formula | C15H21Cl3N4 |
| Molecular Weight | 363.72 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 3-[[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]methyl]-4-chloro-1-methylindazole;dihydrochloride |
| SMILES | Cl.Cl.Cn1nc(CN2CC[C@H]3CNC[C@H]32)c2c(Cl)cccc21 |
| InChI | InChI=1S/C15H19ClN4.2ClH/c1-19-13-4-2-3-11(16)15(13)12(18-19)9-20-6-5-10-7-17-8-14(10)20;;/h2-4,10,14,17H,5-9H2,1H3;2*1H/t10-,14+;;/m0../s1 |
| InChIKey | KQFWKEJOIDDRMQ-GALVKRIVSA-N |
| XLogP | 2.86 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.72 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |